C23H27F2N7O — CID 138612277
(3-amino-1H-1,2,4-triazol-5-yl)-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl-ethylamino]methanol (PubChem CID 138612277) has the molecular formula C23H27F2N7O and a molecular weight of 455.51 g/mol. Its IUPAC name is (3-amino-1H-1,2,4-triazol-5-yl)-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl-ethylamino]methanol.
| Compound Name | (3-amino-1H-1,2,4-triazol-5-yl)-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl-ethylamino]methanol |
|---|---|
| PubChem CID | 138612277 |
| Molecular Formula | C23H27F2N7O |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | (3-amino-1H-1,2,4-triazol-5-yl)-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl-ethylamino]methanol |
| SMILES | CCN(C[C@@]12CC[C@@H](c3cc(-c4c(F)cccc4F)nnc31)C2(C)C)C(O)c1nc(N)n[nH]1 |
| InChI | InChI=1S/C23H27F2N7O/c1-4-32(20(33)19-27-21(26)31-30-19)11-23-9-8-13(22(23,2)3)12-10-16(28-29-18(12)23)17-14(24)6-5-7-15(17)25/h5-7,10,13,20,33H,4,8-9,11H2,1-3H3,(H3,26,27,30,31)/t13-,20?,23-/m0/s1 |
| InChIKey | CQKXJZZBWMNHGJ-LOGNXHPDSA-N |
| XLogP | 3.29 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|