About N-[2-(1-ethylpiperidin-4-yl)-2-hydroxyethyl]-2,2,2-trifluoroacetamide
N-[2-(1-ethylpiperidin-4-yl)-2-hydroxyethyl]-2,2,2-trifluoroacetamide (PubChem CID 138612292) has the molecular formula C11H19F3N2O2
and a molecular weight of 268.28 g/mol. Its IUPAC name is N-[2-(1-ethylpiperidin-4-yl)-2-hydroxyethyl]-2,2,2-trifluoroacetamide.
Molecular Properties
| Compound Name | N-[2-(1-ethylpiperidin-4-yl)-2-hydroxyethyl]-2,2,2-trifluoroacetamide |
| PubChem CID | 138612292 |
| Molecular Formula | C11H19F3N2O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N-[2-(1-ethylpiperidin-4-yl)-2-hydroxyethyl]-2,2,2-trifluoroacetamide |
| SMILES | CCN1CCC(C(O)CNC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H19F3N2O2/c1-2-16-5-3-8(4-6-16)9(17)7-15-10(18)11(12,13)14/h8-9,17H,2-7H2,1H3,(H,15,18) |
| InChIKey | DHJAUVZLGFXKQJ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(1-ethylpiperidin-4-yl)-2-hydroxyethyl]-2,2,2-trifluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1-ethylpiperidin-4-yl)-2-hydroxyethyl]-2,2,2-trifluoroacetamide?
The IUPAC name of N-[2-(1-ethylpiperidin-4-yl)-2-hydroxyethyl]-2,2,2-trifluoroacetamide (CID 138612292) is N-[2-(1-ethylpiperidin-4-yl)-2-hydroxyethyl]-2,2,2-trifluoroacetamide.
What is the SMILES notation for N-[2-(1-ethylpiperidin-4-yl)-2-hydroxyethyl]-2,2,2-trifluoroacetamide?
The canonical SMILES for N-[2-(1-ethylpiperidin-4-yl)-2-hydroxyethyl]-2,2,2-trifluoroacetamide is CCN1CCC(C(O)CNC(=O)C(F)(F)F)CC1.
What is the InChIKey of N-[2-(1-ethylpiperidin-4-yl)-2-hydroxyethyl]-2,2,2-trifluoroacetamide?
The InChIKey is DHJAUVZLGFXKQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F3N2O2/c1-2-16-5-3-8(4-6-16)9(17)7-15-10(18)11(12,13)14/h8-9,17H,2-7H2,1H3,(H,15,18).
What are the key properties of N-[2-(1-ethylpiperidin-4-yl)-2-hydroxyethyl]-2,2,2-trifluoroacetamide?
N-[2-(1-ethylpiperidin-4-yl)-2-hydroxyethyl]-2,2,2-trifluoroacetamide has a molecular weight of 268.28 g/mol, XLogP of 0.76, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1-ethylpiperidin-4-yl)-2-hydroxyethyl]-2,2,2-trifluoroacetamide is sourced from PubChem (CID 138612292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).