About 5-(methoxymethyl)-1,3-dioxan-2-one
5-(methoxymethyl)-1,3-dioxan-2-one (PubChem CID 138612880) has the molecular formula C6H10O4
and a molecular weight of 146.14 g/mol. Its IUPAC name is 5-(methoxymethyl)-1,3-dioxan-2-one.
Molecular Properties
| Compound Name | 5-(methoxymethyl)-1,3-dioxan-2-one |
| PubChem CID | 138612880 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 5-(methoxymethyl)-1,3-dioxan-2-one |
| SMILES | COCC1COC(=O)OC1 |
| InChI | InChI=1S/C6H10O4/c1-8-2-5-3-9-6(7)10-4-5/h5H,2-4H2,1H3 |
| InChIKey | MXJDQDGNEKMDNL-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(methoxymethyl)-1,3-dioxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(methoxymethyl)-1,3-dioxan-2-one?
The IUPAC name of 5-(methoxymethyl)-1,3-dioxan-2-one (CID 138612880) is 5-(methoxymethyl)-1,3-dioxan-2-one.
What is the SMILES notation for 5-(methoxymethyl)-1,3-dioxan-2-one?
The canonical SMILES for 5-(methoxymethyl)-1,3-dioxan-2-one is COCC1COC(=O)OC1.
What is the InChIKey of 5-(methoxymethyl)-1,3-dioxan-2-one?
The InChIKey is MXJDQDGNEKMDNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O4/c1-8-2-5-3-9-6(7)10-4-5/h5H,2-4H2,1H3.
What are the key properties of 5-(methoxymethyl)-1,3-dioxan-2-one?
5-(methoxymethyl)-1,3-dioxan-2-one has a molecular weight of 146.14 g/mol, XLogP of 0.42, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(methoxymethyl)-1,3-dioxan-2-one is sourced from PubChem (CID 138612880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).