C10H13NO — CID 138613045
(1E,5Z,7Z)-2-methylcycloocta-1,5,7-triene-1-carboxamide (PubChem CID 138613045) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is (1E,5Z,7Z)-2-methylcycloocta-1,5,7-triene-1-carboxamide.
| Compound Name | (1E,5Z,7Z)-2-methylcycloocta-1,5,7-triene-1-carboxamide |
|---|---|
| PubChem CID | 138613045 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (1E,5Z,7Z)-2-methylcycloocta-1,5,7-triene-1-carboxamide |
| SMILES | C/C1=C(C(N)=O)/C=C\C=C/CC1 |
| InChI | InChI=1S/C10H13NO/c1-8-6-4-2-3-5-7-9(8)10(11)12/h2-3,5,7H,4,6H2,1H3,(H2,11,12)/b3-2-,7-5-,9-8+ |
| InChIKey | LMDMBYZCCFALHZ-DLFQGQCKSA-N |
| XLogP | 1.69 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |