C22H32N2O2 — CID 138613229
[(5S,6S)-5-[(1aS,3aS,6aR)-6b-(hydroxymethyl)-3a-methyl-4-methylidene-1,2,3,5,6,6a-hexahydrocyclopropa[e]inden-1a-yl]-5-methyl-1,4,6,7-tetrahydroindazol-6-yl]methanol (PubChem CID 138613229) has the molecular formula C22H32N2O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is [(5S,6S)-5-[(1aS,3aS,6aR)-6b-(hydroxymethyl)-3a-methyl-4-methylidene-1,2,3,5,6,6a-hexahydrocyclopropa[e]inden-1a-yl]-5-methyl-1,4,6,7-tetrahydroindazol-6-yl]methanol.
| Compound Name | [(5S,6S)-5-[(1aS,3aS,6aR)-6b-(hydroxymethyl)-3a-methyl-4-methylidene-1,2,3,5,6,6a-hexahydrocyclopropa[e]inden-1a-yl]-5-methyl-1,4,6,7-tetrahydroindazol-6-yl]methanol |
|---|---|
| PubChem CID | 138613229 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | [(5S,6S)-5-[(1aS,3aS,6aR)-6b-(hydroxymethyl)-3a-methyl-4-methylidene-1,2,3,5,6,6a-hexahydrocyclopropa[e]inden-1a-yl]-5-methyl-1,4,6,7-tetrahydroindazol-6-yl]methanol |
| SMILES | C=C1CC[C@H]2C3(CO)C[C@]3([C@@]3(C)Cc4cn[nH]c4C[C@@H]3CO)CC[C@]12C |
| InChI | InChI=1S/C22H32N2O2/c1-14-4-5-18-19(14,2)6-7-22(12-21(18,22)13-26)20(3)9-15-10-23-24-17(15)8-16(20)11-25/h10,16,18,25-26H,1,4-9,11-13H2,2-3H3,(H,23,24)/t16-,18-,19-,20+,21?,22+/m1/s1 |
| InChIKey | YCNIPELUDYFVCC-ZCTOMDOVSA-N |
| XLogP | 3.26 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|