C48H42N2 — CID 138613805
7-[3-[9-(4-cyclohexa-1,5-dien-1-ylphenyl)-1,2,4b,8a-tetrahydrocarbazol-3-yl]cyclohexa-1,5-dien-1-yl]-9-phenyl-4a,9a-dihydrocarbazole (PubChem CID 138613805) has the molecular formula C48H42N2 and a molecular weight of 646.88 g/mol. Its IUPAC name is 7-[3-[9-(4-cyclohexa-1,5-dien-1-ylphenyl)-1,2,4b,8a-tetrahydrocarbazol-3-yl]cyclohexa-1,5-dien-1-yl]-9-phenyl-4a,9a-dihydrocarbazole.
| Compound Name | 7-[3-[9-(4-cyclohexa-1,5-dien-1-ylphenyl)-1,2,4b,8a-tetrahydrocarbazol-3-yl]cyclohexa-1,5-dien-1-yl]-9-phenyl-4a,9a-dihydrocarbazole |
|---|---|
| PubChem CID | 138613805 |
| Molecular Formula | C48H42N2 |
| Molecular Weight | 646.88 g/mol |
| Exact Mass | 646.33 |
| IUPAC Name | 7-[3-[9-(4-cyclohexa-1,5-dien-1-ylphenyl)-1,2,4b,8a-tetrahydrocarbazol-3-yl]cyclohexa-1,5-dien-1-yl]-9-phenyl-4a,9a-dihydrocarbazole |
| SMILES | C1=CC2C3=C(CCC(C4C=C(c5ccc6c(c5)N(c5ccccc5)C5C=CC=CC65)C=CC4)=C3)N(c3ccc(C4=CCCC=C4)cc3)C2C=C1 |
| InChI | InChI=1S/C48H42N2/c1-3-12-33(13-4-1)34-22-26-40(27-23-34)49-46-21-10-8-19-42(46)44-31-37(25-29-47(44)49)35-14-11-15-36(30-35)38-24-28-43-41-18-7-9-20-45(41)50(48(43)32-38)39-16-5-2-6-17-39/h2-3,5-13,15-24,26-28,30-32,35,41-42,45-46H,1,4,14,25,29H2 |
| InChIKey | ZWJHVGKRXPXNAW-UHFFFAOYSA-N |
| XLogP | 11.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.88 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |