C51H44N2 — CID 138613963
2-(9-cyclohexa-2,4-dien-1-yl-4b,8a-dihydrocarbazol-3-yl)-9-[(1E,3Z,7E)-7-cyclohexa-2,4-dien-1-yl-4-methyl-3-phenylcycloocta-1,3,7-trien-1-yl]carbazole (PubChem CID 138613963) has the molecular formula C51H44N2 and a molecular weight of 684.93 g/mol. Its IUPAC name is 2-(9-cyclohexa-2,4-dien-1-yl-4b,8a-dihydrocarbazol-3-yl)-9-[(1E,3Z,7E)-7-cyclohexa-2,4-dien-1-yl-4-methyl-3-phenylcycloocta-1,3,7-trien-1-yl]carbazole.
| Compound Name | 2-(9-cyclohexa-2,4-dien-1-yl-4b,8a-dihydrocarbazol-3-yl)-9-[(1E,3Z,7E)-7-cyclohexa-2,4-dien-1-yl-4-methyl-3-phenylcycloocta-1,3,7-trien-1-yl]carbazole |
|---|---|
| PubChem CID | 138613963 |
| Molecular Formula | C51H44N2 |
| Molecular Weight | 684.93 g/mol |
| Exact Mass | 684.35 |
| IUPAC Name | 2-(9-cyclohexa-2,4-dien-1-yl-4b,8a-dihydrocarbazol-3-yl)-9-[(1E,3Z,7E)-7-cyclohexa-2,4-dien-1-yl-4-methyl-3-phenylcycloocta-1,3,7-trien-1-yl]carbazole |
| SMILES | C/C1=C(c2ccccc2)/C=C(n2c3ccccc3c3ccc(-c4ccc5c(c4)C4C=CC=CC4N5C4C=CC=CC4)cc32)\C=C(\C2C=CC=CC2)CC1 |
| InChI | InChI=1S/C51H44N2/c1-35-25-26-38(36-15-5-2-6-16-36)31-42(34-46(35)37-17-7-3-8-18-37)53-48-23-13-11-21-43(48)45-29-27-40(33-51(45)53)39-28-30-50-47(32-39)44-22-12-14-24-49(44)52(50)41-19-9-4-10-20-41/h2-15,17-19,21-24,27-34,36,41,44,49H,16,20,25-26H2,1H3/b38-31+,42-34+,46-35+ |
| InChIKey | QSAJGLKHPPMWIP-QIMYLSLXSA-N |
| XLogP | 12.91 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.93 |
| LogP ≤ 5 | 12.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |