About N-heptyl-1-[3-methyl-4-(4-prop-1-en-2-ylpiperidin-4-yl)cyclohexa-1,3-dien-1-yl]methanimine
N-heptyl-1-[3-methyl-4-(4-prop-1-en-2-ylpiperidin-4-yl)cyclohexa-1,3-dien-1-yl]methanimine (PubChem CID 138614306) has the molecular formula C23H38N2
and a molecular weight of 342.57 g/mol. Its IUPAC name is N-heptyl-1-[3-methyl-4-(4-prop-1-en-2-ylpiperidin-4-yl)cyclohexa-1,3-dien-1-yl]methanimine.
Molecular Properties
| Compound Name | N-heptyl-1-[3-methyl-4-(4-prop-1-en-2-ylpiperidin-4-yl)cyclohexa-1,3-dien-1-yl]methanimine |
| PubChem CID | 138614306 |
| Molecular Formula | C23H38N2 |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 342.30 |
| IUPAC Name | N-heptyl-1-[3-methyl-4-(4-prop-1-en-2-ylpiperidin-4-yl)cyclohexa-1,3-dien-1-yl]methanimine |
| SMILES | C=C(C)C1(C2=C(C)C=C(/C=N/CCCCCCC)CC2)CCNCC1 |
| InChI | InChI=1S/C23H38N2/c1-5-6-7-8-9-14-25-18-21-10-11-22(20(4)17-21)23(19(2)3)12-15-24-16-13-23/h17-18,24H,2,5-16H2,1,3-4H3/b25-18+ |
| InChIKey | DLKPEPCMWLIKDL-XIEYBQDHSA-N |
| XLogP | 6.01 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-heptyl-1-[3-methyl-4-(4-prop-1-en-2-ylpiperidin-4-yl)cyclohexa-1,3-dien-1-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-heptyl-1-[3-methyl-4-(4-prop-1-en-2-ylpiperidin-4-yl)cyclohexa-1,3-dien-1-yl]methanimine?
The IUPAC name of N-heptyl-1-[3-methyl-4-(4-prop-1-en-2-ylpiperidin-4-yl)cyclohexa-1,3-dien-1-yl]methanimine (CID 138614306) is N-heptyl-1-[3-methyl-4-(4-prop-1-en-2-ylpiperidin-4-yl)cyclohexa-1,3-dien-1-yl]methanimine.
What is the SMILES notation for N-heptyl-1-[3-methyl-4-(4-prop-1-en-2-ylpiperidin-4-yl)cyclohexa-1,3-dien-1-yl]methanimine?
The canonical SMILES for N-heptyl-1-[3-methyl-4-(4-prop-1-en-2-ylpiperidin-4-yl)cyclohexa-1,3-dien-1-yl]methanimine is C=C(C)C1(C2=C(C)C=C(/C=N/CCCCCCC)CC2)CCNCC1.
What is the InChIKey of N-heptyl-1-[3-methyl-4-(4-prop-1-en-2-ylpiperidin-4-yl)cyclohexa-1,3-dien-1-yl]methanimine?
The InChIKey is DLKPEPCMWLIKDL-XIEYBQDHSA-N. The full InChI is InChI=1S/C23H38N2/c1-5-6-7-8-9-14-25-18-21-10-11-22(20(4)17-21)23(19(2)3)12-15-24-16-13-23/h17-18,24H,2,5-16H2,1,3-4H3/b25-18+.
What are the key properties of N-heptyl-1-[3-methyl-4-(4-prop-1-en-2-ylpiperidin-4-yl)cyclohexa-1,3-dien-1-yl]methanimine?
N-heptyl-1-[3-methyl-4-(4-prop-1-en-2-ylpiperidin-4-yl)cyclohexa-1,3-dien-1-yl]methanimine has a molecular weight of 342.57 g/mol, XLogP of 6.01, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-heptyl-1-[3-methyl-4-(4-prop-1-en-2-ylpiperidin-4-yl)cyclohexa-1,3-dien-1-yl]methanimine is sourced from PubChem (CID 138614306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).