C34H40N2OS — CID 138614584
(E)-5-[4-(1-cyclopropylpiperidin-4-yl)phenyl]-5-[4-(cyclopropylsulfanylamino)phenyl]-4-phenylpent-4-en-1-ol (PubChem CID 138614584) has the molecular formula C34H40N2OS and a molecular weight of 524.77 g/mol. Its IUPAC name is (E)-5-[4-(1-cyclopropylpiperidin-4-yl)phenyl]-5-[4-(cyclopropylsulfanylamino)phenyl]-4-phenylpent-4-en-1-ol.
| Compound Name | (E)-5-[4-(1-cyclopropylpiperidin-4-yl)phenyl]-5-[4-(cyclopropylsulfanylamino)phenyl]-4-phenylpent-4-en-1-ol |
|---|---|
| PubChem CID | 138614584 |
| Molecular Formula | C34H40N2OS |
| Molecular Weight | 524.77 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | (E)-5-[4-(1-cyclopropylpiperidin-4-yl)phenyl]-5-[4-(cyclopropylsulfanylamino)phenyl]-4-phenylpent-4-en-1-ol |
| SMILES | OCCC/C(=C(\c1ccc(NSC2CC2)cc1)c1ccc(C2CCN(C3CC3)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C34H40N2OS/c37-24-4-7-33(27-5-2-1-3-6-27)34(29-12-14-30(15-13-29)35-38-32-18-19-32)28-10-8-25(9-11-28)26-20-22-36(23-21-26)31-16-17-31/h1-3,5-6,8-15,26,31-32,35,37H,4,7,16-24H2/b34-33+ |
| InChIKey | IZHSZRCDIYVCKT-JEIPZWNWSA-N |
| XLogP | 7.98 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.77 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|