C36H45N3O5 — CID 138614625
tert-butyl (3aS,6aS)-3a-amino-2-[2-[4-[(Z)-5-hydroxy-1-(4-hydroxyphenyl)-2-phenylpent-1-enyl]phenoxy]ethyl]-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 138614625) has the molecular formula C36H45N3O5 and a molecular weight of 599.77 g/mol. Its IUPAC name is tert-butyl (3aS,6aS)-3a-amino-2-[2-[4-[(Z)-5-hydroxy-1-(4-hydroxyphenyl)-2-phenylpent-1-enyl]phenoxy]ethyl]-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aS,6aS)-3a-amino-2-[2-[4-[(Z)-5-hydroxy-1-(4-hydroxyphenyl)-2-phenylpent-1-enyl]phenoxy]ethyl]-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 138614625 |
| Molecular Formula | C36H45N3O5 |
| Molecular Weight | 599.77 g/mol |
| Exact Mass | 599.34 |
| IUPAC Name | tert-butyl (3aS,6aS)-3a-amino-2-[2-[4-[(Z)-5-hydroxy-1-(4-hydroxyphenyl)-2-phenylpent-1-enyl]phenoxy]ethyl]-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CN(CCOc3ccc(/C(=C(/CCCO)c4ccccc4)c4ccc(O)cc4)cc3)C[C@]2(N)C1 |
| InChI | InChI=1S/C36H45N3O5/c1-35(2,3)44-34(42)39-23-29-22-38(24-36(29,37)25-39)19-21-43-31-17-13-28(14-18-31)33(27-11-15-30(41)16-12-27)32(10-7-20-40)26-8-5-4-6-9-26/h4-6,8-9,11-18,29,40-41H,7,10,19-25,37H2,1-3H3/b33-32-/t29-,36-/m0/s1 |
| InChIKey | GWJUFZGHPSLVJI-IBFGCLLKSA-N |
| XLogP | 5.38 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.77 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|