C17H24N2 — CID 138615063
(2R,4Z,6Z,9E)-11-N,2,9-trimethyl-8-methylidenetrideca-4,6,9,12-tetraene-1,11-diimine (PubChem CID 138615063) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is (2R,4Z,6Z,9E)-11-N,2,9-trimethyl-8-methylidenetrideca-4,6,9,12-tetraene-1,11-diimine.
| Compound Name | (2R,4Z,6Z,9E)-11-N,2,9-trimethyl-8-methylidenetrideca-4,6,9,12-tetraene-1,11-diimine |
|---|---|
| PubChem CID | 138615063 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | (2R,4Z,6Z,9E)-11-N,2,9-trimethyl-8-methylidenetrideca-4,6,9,12-tetraene-1,11-diimine |
| SMILES | [H]/N=C/[C@H](C)C/C=C\C=C/C(=C)/C(C)=C\C(C=C)=N\C |
| InChI | InChI=1S/C17H24N2/c1-6-17(19-5)12-16(4)15(3)11-9-7-8-10-14(2)13-18/h6-9,11-14,18H,1,3,10H2,2,4-5H3/b8-7-,11-9-,16-12+,18-13+,19-17+/t14-/m1/s1 |
| InChIKey | BXDFIQYHNSUQKE-YWPZRNGWSA-N |
| XLogP | 4.53 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|