C27H42N4O2 — CID 138615444
1-[[5-methyl-2-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]-1,3-oxazol-4-yl]methyl]-N-(3-piperidin-1-ylpropyl)piperidine-4-carboxamide (PubChem CID 138615444) has the molecular formula C27H42N4O2 and a molecular weight of 454.66 g/mol. Its IUPAC name is 1-[[5-methyl-2-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]-1,3-oxazol-4-yl]methyl]-N-(3-piperidin-1-ylpropyl)piperidine-4-carboxamide.
| Compound Name | 1-[[5-methyl-2-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]-1,3-oxazol-4-yl]methyl]-N-(3-piperidin-1-ylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 138615444 |
| Molecular Formula | C27H42N4O2 |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.33 |
| IUPAC Name | 1-[[5-methyl-2-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]-1,3-oxazol-4-yl]methyl]-N-(3-piperidin-1-ylpropyl)piperidine-4-carboxamide |
| SMILES | C=C/C(C)=C\C=C(/C)c1nc(CN2CCC(C(=O)NCCCN3CCCCC3)CC2)c(C)o1 |
| InChI | InChI=1S/C27H42N4O2/c1-5-21(2)10-11-22(3)27-29-25(23(4)33-27)20-31-18-12-24(13-19-31)26(32)28-14-9-17-30-15-7-6-8-16-30/h5,10-11,24H,1,6-9,12-20H2,2-4H3,(H,28,32)/b21-10-,22-11+ |
| InChIKey | QAJOKNHTGCGZGK-PANSPLHPSA-N |
| XLogP | 4.72 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|