C23H22O2 — CID 138616038
(3E,4E)-5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-phenyl-3,4-bis(prop-2-enylidene)oxolan-2-one (PubChem CID 138616038) has the molecular formula C23H22O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is (3E,4E)-5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-phenyl-3,4-bis(prop-2-enylidene)oxolan-2-one.
| Compound Name | (3E,4E)-5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-phenyl-3,4-bis(prop-2-enylidene)oxolan-2-one |
|---|---|
| PubChem CID | 138616038 |
| Molecular Formula | C23H22O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | (3E,4E)-5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-phenyl-3,4-bis(prop-2-enylidene)oxolan-2-one |
| SMILES | C=C/C=C\C(=C/C)C1(c2ccccc2)OC(=O)C(=C/C=C)/C1=C\C=C |
| InChI | InChI=1S/C23H22O2/c1-5-9-15-18(8-4)23(19-16-11-10-12-17-19)21(14-7-3)20(13-6-2)22(24)25-23/h5-17H,1-3H2,4H3/b15-9-,18-8+,20-13+,21-14+ |
| InChIKey | OJTBLDXEKGNDBM-LDIUCYBUSA-N |
| XLogP | 5.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|