C30H33NO — CID 138616074
(3E,4E)-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-5-[(3Z)-hexa-1,3,5-trien-2-yl]-3,4-bis(prop-2-enylidene)pyrrolidin-2-one (PubChem CID 138616074) has the molecular formula C30H33NO and a molecular weight of 423.60 g/mol. Its IUPAC name is (3E,4E)-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-5-[(3Z)-hexa-1,3,5-trien-2-yl]-3,4-bis(prop-2-enylidene)pyrrolidin-2-one.
| Compound Name | (3E,4E)-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-5-[(3Z)-hexa-1,3,5-trien-2-yl]-3,4-bis(prop-2-enylidene)pyrrolidin-2-one |
|---|---|
| PubChem CID | 138616074 |
| Molecular Formula | C30H33NO |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | (3E,4E)-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-5-[(3Z)-hexa-1,3,5-trien-2-yl]-3,4-bis(prop-2-enylidene)pyrrolidin-2-one |
| SMILES | C=C/C=C\C(=C)C1(C(=C)/C=C\C=C/C)C(=C/C=C)/C(=C\C=C)C(=O)N1C(/C=C\C=C)=C/C |
| InChI | InChI=1S/C30H33NO/c1-9-15-18-22-25(8)30(24(7)21-16-10-2)28(20-13-5)27(19-12-4)29(32)31(30)26(14-6)23-17-11-3/h9-23H,2-5,7-8H2,1,6H3/b15-9-,21-16-,22-18-,23-17-,26-14+,27-19+,28-20+ |
| InChIKey | ATRUHUMBQCEQNU-OOIZZXHASA-N |
| XLogP | 7.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|