C32H37NO — CID 138616075
(3E,4E)-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-5-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-3,4-bis(prop-2-enylidene)pyrrolidin-2-one (PubChem CID 138616075) has the molecular formula C32H37NO and a molecular weight of 451.65 g/mol. Its IUPAC name is (3E,4E)-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-5-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-3,4-bis(prop-2-enylidene)pyrrolidin-2-one.
| Compound Name | (3E,4E)-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-5-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-3,4-bis(prop-2-enylidene)pyrrolidin-2-one |
|---|---|
| PubChem CID | 138616075 |
| Molecular Formula | C32H37NO |
| Molecular Weight | 451.65 g/mol |
| Exact Mass | 451.29 |
| IUPAC Name | (3E,4E)-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-5-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-3,4-bis(prop-2-enylidene)pyrrolidin-2-one |
| SMILES | C=C/C=C\C(=C/C)N1C(=O)C(=C/C=C)/C(=C\C=C)C1(C(=C)/C=C\C=C/C)C(/C=C\C)=C/C=C\C |
| InChI | InChI=1S/C32H37NO/c1-9-16-19-23-26(8)32(27(20-12-4)24-17-10-2)30(22-14-6)29(21-13-5)31(34)33(32)28(15-7)25-18-11-3/h9-25H,3,5-6,8H2,1-2,4,7H3/b16-9-,17-10-,20-12-,23-19-,25-18-,27-24+,28-15+,29-21+,30-22+ |
| InChIKey | RIOFPVMUGPFEJJ-PUYVSSCOSA-N |
| XLogP | 8.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.65 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|