C17H35N — CID 138617054
1,2,2,4,4,5,6,6,8,8-decamethylazocane (PubChem CID 138617054) has the molecular formula C17H35N and a molecular weight of 253.47 g/mol. Its IUPAC name is 1,2,2,4,4,5,6,6,8,8-decamethylazocane.
| Compound Name | 1,2,2,4,4,5,6,6,8,8-decamethylazocane |
|---|---|
| PubChem CID | 138617054 |
| Molecular Formula | C17H35N |
| Molecular Weight | 253.47 g/mol |
| Exact Mass | 253.28 |
| IUPAC Name | 1,2,2,4,4,5,6,6,8,8-decamethylazocane |
| SMILES | CC1C(C)(C)CC(C)(C)N(C)C(C)(C)CC1(C)C |
| InChI | InChI=1S/C17H35N/c1-13-14(2,3)11-16(6,7)18(10)17(8,9)12-15(13,4)5/h13H,11-12H2,1-10H3 |
| InChIKey | NCIRSFDACUBVRI-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |