C33H41F4N3O7 — CID 138617085
2-methylpropyl (3S)-3-[[1-[2-(2-tert-butylanilino)-2-oxoacetyl]piperidine-4-carbonyl]amino]-4-hydroxy-5-(2,3,5,6-tetrafluorophenoxy)pentanoate (PubChem CID 138617085) has the molecular formula C33H41F4N3O7 and a molecular weight of 667.70 g/mol. Its IUPAC name is 2-methylpropyl (3S)-3-[[1-[2-(2-tert-butylanilino)-2-oxoacetyl]piperidine-4-carbonyl]amino]-4-hydroxy-5-(2,3,5,6-tetrafluorophenoxy)pentanoate.
| Compound Name | 2-methylpropyl (3S)-3-[[1-[2-(2-tert-butylanilino)-2-oxoacetyl]piperidine-4-carbonyl]amino]-4-hydroxy-5-(2,3,5,6-tetrafluorophenoxy)pentanoate |
|---|---|
| PubChem CID | 138617085 |
| Molecular Formula | C33H41F4N3O7 |
| Molecular Weight | 667.70 g/mol |
| Exact Mass | 667.29 |
| IUPAC Name | 2-methylpropyl (3S)-3-[[1-[2-(2-tert-butylanilino)-2-oxoacetyl]piperidine-4-carbonyl]amino]-4-hydroxy-5-(2,3,5,6-tetrafluorophenoxy)pentanoate |
| SMILES | CC(C)COC(=O)C[C@H](NC(=O)C1CCN(C(=O)C(=O)Nc2ccccc2C(C)(C)C)CC1)C(O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C33H41F4N3O7/c1-18(2)16-46-26(42)15-24(25(41)17-47-29-27(36)21(34)14-22(35)28(29)37)39-30(43)19-10-12-40(13-11-19)32(45)31(44)38-23-9-7-6-8-20(23)33(3,4)5/h6-9,14,18-19,24-25,41H,10-13,15-17H2,1-5H3,(H,38,44)(H,39,43)/t24-,25?/m0/s1 |
| InChIKey | BQJGVULCDVUWBJ-SKCDSABHSA-N |
| XLogP | 4.23 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.70 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|