C19H17N3O — CID 138617273
3,3-dimethyl-1-(2-methylindazol-3-yl)isoquinolin-4-one (PubChem CID 138617273) has the molecular formula C19H17N3O and a molecular weight of 303.37 g/mol. Its IUPAC name is 3,3-dimethyl-1-(2-methylindazol-3-yl)isoquinolin-4-one.
| Compound Name | 3,3-dimethyl-1-(2-methylindazol-3-yl)isoquinolin-4-one |
|---|---|
| PubChem CID | 138617273 |
| Molecular Formula | C19H17N3O |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 3,3-dimethyl-1-(2-methylindazol-3-yl)isoquinolin-4-one |
| SMILES | Cn1nc2ccccc2c1C1=NC(C)(C)C(=O)c2ccccc21 |
| InChI | InChI=1S/C19H17N3O/c1-19(2)18(23)13-9-5-4-8-12(13)16(20-19)17-14-10-6-7-11-15(14)21-22(17)3/h4-11H,1-3H3 |
| InChIKey | LQYAATFAOZUWLF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |