C20H27NO2 — CID 138618885
(8R,9S,13S,14S)-3-methoxy-13-methyl-2-(methylamino)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 138618885) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is (8R,9S,13S,14S)-3-methoxy-13-methyl-2-(methylamino)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-3-methoxy-13-methyl-2-(methylamino)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 138618885 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | (8R,9S,13S,14S)-3-methoxy-13-methyl-2-(methylamino)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | CNc1cc2c(cc1OC)CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C20H27NO2/c1-20-9-8-13-14(16(20)6-7-19(20)22)5-4-12-10-18(23-3)17(21-2)11-15(12)13/h10-11,13-14,16,21H,4-9H2,1-3H3/t13-,14+,16-,20-/m0/s1 |
| InChIKey | KMGVFAQEVNVVNY-IDLUEMFASA-N |
| XLogP | 4.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |