About 3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-bromobenzoic acid;dihydrochloride
3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-bromobenzoic acid;dihydrochloride (PubChem CID 138618949) has the molecular formula C11H11BrCl2N2O4S2
and a molecular weight of 450.16 g/mol. Its IUPAC name is 3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-bromobenzoic acid;dihydrochloride.
Molecular Properties
| Compound Name | 3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-bromobenzoic acid;dihydrochloride |
| PubChem CID | 138618949 |
| Molecular Formula | C11H11BrCl2N2O4S2 |
| Molecular Weight | 450.16 g/mol |
| Exact Mass | 447.87 |
| IUPAC Name | 3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-bromobenzoic acid;dihydrochloride |
| SMILES | Cl.Cl.NCc1ncc(S(=O)(=O)c2cc(Br)cc(C(=O)O)c2)s1 |
| InChI | InChI=1S/C11H9BrN2O4S2.2ClH/c12-7-1-6(11(15)16)2-8(3-7)20(17,18)10-5-14-9(4-13)19-10;;/h1-3,5H,4,13H2,(H,15,16);2*1H |
| InChIKey | OVUAKZGESJJWSB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.16 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-bromobenzoic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-bromobenzoic acid;dihydrochloride?
The IUPAC name of 3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-bromobenzoic acid;dihydrochloride (CID 138618949) is 3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-bromobenzoic acid;dihydrochloride.
What is the SMILES notation for 3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-bromobenzoic acid;dihydrochloride?
The canonical SMILES for 3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-bromobenzoic acid;dihydrochloride is Cl.Cl.NCc1ncc(S(=O)(=O)c2cc(Br)cc(C(=O)O)c2)s1.
What is the InChIKey of 3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-bromobenzoic acid;dihydrochloride?
The InChIKey is OVUAKZGESJJWSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BrN2O4S2.2ClH/c12-7-1-6(11(15)16)2-8(3-7)20(17,18)10-5-14-9(4-13)19-10;;/h1-3,5H,4,13H2,(H,15,16);2*1H.
What are the key properties of 3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-bromobenzoic acid;dihydrochloride?
3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-bromobenzoic acid;dihydrochloride has a molecular weight of 450.16 g/mol, XLogP of 2.74, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-bromobenzoic acid;dihydrochloride is sourced from PubChem (CID 138618949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).