C19H15F6NO2 — CID 138619070
1,1,1,3,3,3-hexafluoropropan-2-yl 5-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 138619070) has the molecular formula C19H15F6NO2 and a molecular weight of 403.32 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 5-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 5-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 138619070 |
| Molecular Formula | C19H15F6NO2 |
| Molecular Weight | 403.32 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 5-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCc2c(cccc2-c2ccccc2)C1 |
| InChI | InChI=1S/C19H15F6NO2/c20-18(21,22)16(19(23,24)25)28-17(27)26-10-9-15-13(11-26)7-4-8-14(15)12-5-2-1-3-6-12/h1-8,16H,9-11H2 |
| InChIKey | STPAVRDZMRMQHA-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.32 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |