C13H11F6NO2 — CID 138619077
1,1,1,3,3,3-hexafluoropropan-2-yl 3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 138619077) has the molecular formula C13H11F6NO2 and a molecular weight of 327.22 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 138619077 |
| Molecular Formula | C13H11F6NO2 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C13H11F6NO2/c14-12(15,16)10(13(17,18)19)22-11(21)20-6-5-8-3-1-2-4-9(8)7-20/h1-4,10H,5-7H2 |
| InChIKey | KZMGERNGWDRNGP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |