C18H21F6N3O3 — CID 138619090
1,1,1,3,3,3-hexafluoropropan-2-yl 5-(2-morpholin-4-ylethylamino)-1,3-dihydroisoindole-2-carboxylate (PubChem CID 138619090) has the molecular formula C18H21F6N3O3 and a molecular weight of 441.37 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 5-(2-morpholin-4-ylethylamino)-1,3-dihydroisoindole-2-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 5-(2-morpholin-4-ylethylamino)-1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 138619090 |
| Molecular Formula | C18H21F6N3O3 |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 5-(2-morpholin-4-ylethylamino)-1,3-dihydroisoindole-2-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1Cc2ccc(NCCN3CCOCC3)cc2C1 |
| InChI | InChI=1S/C18H21F6N3O3/c19-17(20,21)15(18(22,23)24)30-16(28)27-10-12-1-2-14(9-13(12)11-27)25-3-4-26-5-7-29-8-6-26/h1-2,9,15,25H,3-8,10-11H2 |
| InChIKey | FUMCZWLNZUGBHO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |