C16H16F6N2O4S — CID 138619132
1,1,1,3,3,3-hexafluoropropan-2-yl 5-(1,1-dioxo-1,4-thiazinan-4-yl)-1,3-dihydroisoindole-2-carboxylate (PubChem CID 138619132) has the molecular formula C16H16F6N2O4S and a molecular weight of 446.37 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 5-(1,1-dioxo-1,4-thiazinan-4-yl)-1,3-dihydroisoindole-2-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 5-(1,1-dioxo-1,4-thiazinan-4-yl)-1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 138619132 |
| Molecular Formula | C16H16F6N2O4S |
| Molecular Weight | 446.37 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 5-(1,1-dioxo-1,4-thiazinan-4-yl)-1,3-dihydroisoindole-2-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1Cc2ccc(N3CCS(=O)(=O)CC3)cc2C1 |
| InChI | InChI=1S/C16H16F6N2O4S/c17-15(18,19)13(16(20,21)22)28-14(25)24-8-10-1-2-12(7-11(10)9-24)23-3-5-29(26,27)6-4-23/h1-2,7,13H,3-6,8-9H2 |
| InChIKey | UXKDVCLPQQRLCK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|