C18H20F6N2O3 — CID 138619142
1,1,1,3,3,3-hexafluoropropan-2-yl 5-(2-pyrrolidin-1-ylethoxy)-1,3-dihydroisoindole-2-carboxylate (PubChem CID 138619142) has the molecular formula C18H20F6N2O3 and a molecular weight of 426.36 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 5-(2-pyrrolidin-1-ylethoxy)-1,3-dihydroisoindole-2-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 5-(2-pyrrolidin-1-ylethoxy)-1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 138619142 |
| Molecular Formula | C18H20F6N2O3 |
| Molecular Weight | 426.36 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 5-(2-pyrrolidin-1-ylethoxy)-1,3-dihydroisoindole-2-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1Cc2ccc(OCCN3CCCC3)cc2C1 |
| InChI | InChI=1S/C18H20F6N2O3/c19-17(20,21)15(18(22,23)24)29-16(27)26-10-12-3-4-14(9-13(12)11-26)28-8-7-25-5-1-2-6-25/h3-4,9,15H,1-2,5-8,10-11H2 |
| InChIKey | JSVZSXGEGFZWPP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.36 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |