C14H13F6NO2 — CID 138619144
1,1,1,3,3,3-hexafluoropropan-2-yl 4-methyl-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 138619144) has the molecular formula C14H13F6NO2 and a molecular weight of 341.25 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-methyl-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-methyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 138619144 |
| Molecular Formula | C14H13F6NO2 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-methyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC1CN(C(=O)OC(C(F)(F)F)C(F)(F)F)Cc2ccccc21 |
| InChI | InChI=1S/C14H13F6NO2/c1-8-6-21(7-9-4-2-3-5-10(8)9)12(22)23-11(13(15,16)17)14(18,19)20/h2-5,8,11H,6-7H2,1H3 |
| InChIKey | VYSSVYQQGYLHTG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |