C8H6Cl4N2O4 — CID 138619577
oxalic acid;(2,3,4,6-tetrachlorophenyl)hydrazine (PubChem CID 138619577) has the molecular formula C8H6Cl4N2O4 and a molecular weight of 335.96 g/mol. Its IUPAC name is oxalic acid;(2,3,4,6-tetrachlorophenyl)hydrazine.
| Compound Name | oxalic acid;(2,3,4,6-tetrachlorophenyl)hydrazine |
|---|---|
| PubChem CID | 138619577 |
| Molecular Formula | C8H6Cl4N2O4 |
| Molecular Weight | 335.96 g/mol |
| Exact Mass | 333.91 |
| IUPAC Name | oxalic acid;(2,3,4,6-tetrachlorophenyl)hydrazine |
| SMILES | NNc1c(Cl)cc(Cl)c(Cl)c1Cl.O=C(O)C(=O)O |
| InChI | InChI=1S/C6H4Cl4N2.C2H2O4/c7-2-1-3(8)6(12-11)5(10)4(2)9;3-1(4)2(5)6/h1,12H,11H2;(H,3,4)(H,5,6) |
| InChIKey | BAXCHCYMAXPGAZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.96 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|