About (2,3,5-trichlorophenyl)hydrazine;hydrobromide
(2,3,5-trichlorophenyl)hydrazine;hydrobromide (PubChem CID 138619704) has the molecular formula C6H6BrCl3N2
and a molecular weight of 292.39 g/mol. Its IUPAC name is (2,3,5-trichlorophenyl)hydrazine;hydrobromide.
Molecular Properties
| Compound Name | (2,3,5-trichlorophenyl)hydrazine;hydrobromide |
| PubChem CID | 138619704 |
| Molecular Formula | C6H6BrCl3N2 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 289.88 |
| IUPAC Name | (2,3,5-trichlorophenyl)hydrazine;hydrobromide |
| SMILES | Br.NNc1cc(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C6H5Cl3N2.BrH/c7-3-1-4(8)6(9)5(2-3)11-10;/h1-2,11H,10H2;1H |
| InChIKey | GOGKDRLIMVCUOT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2,3,5-trichlorophenyl)hydrazine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3,5-trichlorophenyl)hydrazine;hydrobromide?
The IUPAC name of (2,3,5-trichlorophenyl)hydrazine;hydrobromide (CID 138619704) is (2,3,5-trichlorophenyl)hydrazine;hydrobromide.
What is the SMILES notation for (2,3,5-trichlorophenyl)hydrazine;hydrobromide?
The canonical SMILES for (2,3,5-trichlorophenyl)hydrazine;hydrobromide is Br.NNc1cc(Cl)cc(Cl)c1Cl.
What is the InChIKey of (2,3,5-trichlorophenyl)hydrazine;hydrobromide?
The InChIKey is GOGKDRLIMVCUOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Cl3N2.BrH/c7-3-1-4(8)6(9)5(2-3)11-10;/h1-2,11H,10H2;1H.
What are the key properties of (2,3,5-trichlorophenyl)hydrazine;hydrobromide?
(2,3,5-trichlorophenyl)hydrazine;hydrobromide has a molecular weight of 292.39 g/mol, XLogP of 3.51, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3,5-trichlorophenyl)hydrazine;hydrobromide is sourced from PubChem (CID 138619704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).