C20H26N4O4 — CID 138619746
1-N',2-N'-bis(4-propoxyphenyl)ethanedihydrazide (PubChem CID 138619746) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is 1-N',2-N'-bis(4-propoxyphenyl)ethanedihydrazide.
| Compound Name | 1-N',2-N'-bis(4-propoxyphenyl)ethanedihydrazide |
|---|---|
| PubChem CID | 138619746 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 1-N',2-N'-bis(4-propoxyphenyl)ethanedihydrazide |
| SMILES | CCCOc1ccc(NNC(=O)C(=O)NNc2ccc(OCCC)cc2)cc1 |
| InChI | InChI=1S/C20H26N4O4/c1-3-13-27-17-9-5-15(6-10-17)21-23-19(25)20(26)24-22-16-7-11-18(12-8-16)28-14-4-2/h5-12,21-22H,3-4,13-14H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | YKXDXYSEKKXDQY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|