sulfuric acid;(2,3,5-trichlorophenyl)hydrazine

C6H7Cl3N2O4S — CID 138619800

IUPACsulfuric acid;(2,3,5-trichlorophenyl)hydrazine
SMILESNNc1cc(Cl)cc(Cl)c1Cl.O=S(=O)(O)O
InChIInChI=1S/C6H5Cl3N2.H2O4S/c7-3-1-4(8)6(9)5(2-3)11-10;1-5(2,3)4/h1-2,11H,10H2;(H2,1,2,3,4)
InChIKeyURAMKFKOIYMYGX-UHFFFAOYSA-N
MW309.56 g/mol
LogP2.28
Rot. Bonds1

About sulfuric acid;(2,3,5-trichlorophenyl)hydrazine

sulfuric acid;(2,3,5-trichlorophenyl)hydrazine (PubChem CID 138619800) has the molecular formula C6H7Cl3N2O4S and a molecular weight of 309.56 g/mol. Its IUPAC name is sulfuric acid;(2,3,5-trichlorophenyl)hydrazine.

Molecular Properties

Compound Namesulfuric acid;(2,3,5-trichlorophenyl)hydrazine
PubChem CID138619800
Molecular FormulaC6H7Cl3N2O4S
Molecular Weight309.56 g/mol
Exact Mass307.92
IUPAC Namesulfuric acid;(2,3,5-trichlorophenyl)hydrazine
SMILESNNc1cc(Cl)cc(Cl)c1Cl.O=S(=O)(O)O
InChIInChI=1S/C6H5Cl3N2.H2O4S/c7-3-1-4(8)6(9)5(2-3)11-10;1-5(2,3)4/h1-2,11H,10H2;(H2,1,2,3,4)
InChIKeyURAMKFKOIYMYGX-UHFFFAOYSA-N
XLogP2.28
TPSA112.65 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500309.56
LogP ≤ 52.28
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze sulfuric acid;(2,3,5-trichlorophenyl)hydrazine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sulfuric acid;(2,3,5-trichlorophenyl)hydrazine?
The IUPAC name of sulfuric acid;(2,3,5-trichlorophenyl)hydrazine (CID 138619800) is sulfuric acid;(2,3,5-trichlorophenyl)hydrazine.
What is the SMILES notation for sulfuric acid;(2,3,5-trichlorophenyl)hydrazine?
The canonical SMILES for sulfuric acid;(2,3,5-trichlorophenyl)hydrazine is NNc1cc(Cl)cc(Cl)c1Cl.O=S(=O)(O)O.
What is the InChIKey of sulfuric acid;(2,3,5-trichlorophenyl)hydrazine?
The InChIKey is URAMKFKOIYMYGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Cl3N2.H2O4S/c7-3-1-4(8)6(9)5(2-3)11-10;1-5(2,3)4/h1-2,11H,10H2;(H2,1,2,3,4).
What are the key properties of sulfuric acid;(2,3,5-trichlorophenyl)hydrazine?
sulfuric acid;(2,3,5-trichlorophenyl)hydrazine has a molecular weight of 309.56 g/mol, XLogP of 2.28, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sulfuric acid;(2,3,5-trichlorophenyl)hydrazine is sourced from PubChem (CID 138619800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).