About (2,3,4,6-tetrachlorophenyl)hydrazine;hydrochloride
(2,3,4,6-tetrachlorophenyl)hydrazine;hydrochloride (PubChem CID 138619876) has the molecular formula C6H5Cl5N2
and a molecular weight of 282.39 g/mol. Its IUPAC name is (2,3,4,6-tetrachlorophenyl)hydrazine;hydrochloride.
Molecular Properties
| Compound Name | (2,3,4,6-tetrachlorophenyl)hydrazine;hydrochloride |
| PubChem CID | 138619876 |
| Molecular Formula | C6H5Cl5N2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 279.89 |
| IUPAC Name | (2,3,4,6-tetrachlorophenyl)hydrazine;hydrochloride |
| SMILES | Cl.NNc1c(Cl)cc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C6H4Cl4N2.ClH/c7-2-1-3(8)6(12-11)5(10)4(2)9;/h1,12H,11H2;1H |
| InChIKey | ZHUNGENFKSMMJH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2,3,4,6-tetrachlorophenyl)hydrazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3,4,6-tetrachlorophenyl)hydrazine;hydrochloride?
The IUPAC name of (2,3,4,6-tetrachlorophenyl)hydrazine;hydrochloride (CID 138619876) is (2,3,4,6-tetrachlorophenyl)hydrazine;hydrochloride.
What is the SMILES notation for (2,3,4,6-tetrachlorophenyl)hydrazine;hydrochloride?
The canonical SMILES for (2,3,4,6-tetrachlorophenyl)hydrazine;hydrochloride is Cl.NNc1c(Cl)cc(Cl)c(Cl)c1Cl.
What is the InChIKey of (2,3,4,6-tetrachlorophenyl)hydrazine;hydrochloride?
The InChIKey is ZHUNGENFKSMMJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl4N2.ClH/c7-2-1-3(8)6(12-11)5(10)4(2)9;/h1,12H,11H2;1H.
What are the key properties of (2,3,4,6-tetrachlorophenyl)hydrazine;hydrochloride?
(2,3,4,6-tetrachlorophenyl)hydrazine;hydrochloride has a molecular weight of 282.39 g/mol, XLogP of 4.01, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3,4,6-tetrachlorophenyl)hydrazine;hydrochloride is sourced from PubChem (CID 138619876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).