C39H37F4N5O8 — CID 138620605
N-[1-[4-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethoxy]ethoxymethyl]cyclohexyl]-5-fluorobenzimidazol-2-yl]-3-(trifluoromethyl)benzamide (PubChem CID 138620605) has the molecular formula C39H37F4N5O8 and a molecular weight of 779.74 g/mol. Its IUPAC name is N-[1-[4-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethoxy]ethoxymethyl]cyclohexyl]-5-fluorobenzimidazol-2-yl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[1-[4-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethoxy]ethoxymethyl]cyclohexyl]-5-fluorobenzimidazol-2-yl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 138620605 |
| Molecular Formula | C39H37F4N5O8 |
| Molecular Weight | 779.74 g/mol |
| Exact Mass | 779.26 |
| IUPAC Name | N-[1-[4-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethoxy]ethoxymethyl]cyclohexyl]-5-fluorobenzimidazol-2-yl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C1CCC(N2C(=O)c3ccc(OCCOCCOCC4CCC(n5c(NC(=O)c6cccc(C(F)(F)F)c6)nc6cc(F)ccc65)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C39H37F4N5O8/c40-25-6-11-31-30(19-25)44-38(46-34(50)23-2-1-3-24(18-23)39(41,42)43)47(31)26-7-4-22(5-8-26)21-55-15-14-54-16-17-56-27-9-10-28-29(20-27)37(53)48(36(28)52)32-12-13-33(49)45-35(32)51/h1-3,6,9-11,18-20,22,26,32H,4-5,7-8,12-17,21H2,(H,44,46,50)(H,45,49,51) |
| InChIKey | HIXWIFGCSKAHLU-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 158.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.74 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|