C27H21Cl2FN3O4S- — CID 138621339
1-[4-[2-[3,5-dichloro-4-[1-[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]cyclopropyl]anilino]-2-oxoethyl]phenyl]ethanesulfinate (PubChem CID 138621339) has the molecular formula C27H21Cl2FN3O4S- and a molecular weight of 573.45 g/mol. Its IUPAC name is 1-[4-[2-[3,5-dichloro-4-[1-[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]cyclopropyl]anilino]-2-oxoethyl]phenyl]ethanesulfinate.
| Compound Name | 1-[4-[2-[3,5-dichloro-4-[1-[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]cyclopropyl]anilino]-2-oxoethyl]phenyl]ethanesulfinate |
|---|---|
| PubChem CID | 138621339 |
| Molecular Formula | C27H21Cl2FN3O4S- |
| Molecular Weight | 573.45 g/mol |
| Exact Mass | 572.06 |
| IUPAC Name | 1-[4-[2-[3,5-dichloro-4-[1-[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]cyclopropyl]anilino]-2-oxoethyl]phenyl]ethanesulfinate |
| SMILES | CC(c1ccc(CC(=O)Nc2cc(Cl)c(C3(c4noc(-c5ccc(F)cc5)n4)CC3)c(Cl)c2)cc1)S(=O)[O-] |
| InChI | InChI=1S/C27H22Cl2FN3O4S/c1-15(38(35)36)17-4-2-16(3-5-17)12-23(34)31-20-13-21(28)24(22(29)14-20)27(10-11-27)26-32-25(37-33-26)18-6-8-19(30)9-7-18/h2-9,13-15H,10-12H2,1H3,(H,31,34)(H,35,36)/p-1 |
| InChIKey | LLWFRQJIWDSSIV-UHFFFAOYSA-M |
| XLogP | 6.38 |
| TPSA | 108.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.45 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|