C25H27N3O5 — CID 138621669
1-[(3S)-1-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]piperidin-3-yl]-3-[(1R)-1-phenylethyl]imidazolidine-2,4,5-trione (PubChem CID 138621669) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is 1-[(3S)-1-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]piperidin-3-yl]-3-[(1R)-1-phenylethyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-[(3S)-1-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]piperidin-3-yl]-3-[(1R)-1-phenylethyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 138621669 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 1-[(3S)-1-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]piperidin-3-yl]-3-[(1R)-1-phenylethyl]imidazolidine-2,4,5-trione |
| SMILES | C[C@H](c1ccccc1)N1C(=O)C(=O)N([C@H]2CCCN(C[C@H]3COc4ccccc4O3)C2)C1=O |
| InChI | InChI=1S/C25H27N3O5/c1-17(18-8-3-2-4-9-18)27-23(29)24(30)28(25(27)31)19-10-7-13-26(14-19)15-20-16-32-21-11-5-6-12-22(21)33-20/h2-6,8-9,11-12,17,19-20H,7,10,13-16H2,1H3/t17-,19+,20+/m1/s1 |
| InChIKey | GUUSBMJRVZGMTA-HOJAQTOUSA-N |
| XLogP | 2.84 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|