C15H31NS — CID 138623006
(E)-N-[3-(2,2-dimethylpropylsulfanyl)propyl]-2,3,3-trimethylbut-1-en-1-amine (PubChem CID 138623006) has the molecular formula C15H31NS and a molecular weight of 257.49 g/mol. Its IUPAC name is (E)-N-[3-(2,2-dimethylpropylsulfanyl)propyl]-2,3,3-trimethylbut-1-en-1-amine.
| Compound Name | (E)-N-[3-(2,2-dimethylpropylsulfanyl)propyl]-2,3,3-trimethylbut-1-en-1-amine |
|---|---|
| PubChem CID | 138623006 |
| Molecular Formula | C15H31NS |
| Molecular Weight | 257.49 g/mol |
| Exact Mass | 257.22 |
| IUPAC Name | (E)-N-[3-(2,2-dimethylpropylsulfanyl)propyl]-2,3,3-trimethylbut-1-en-1-amine |
| SMILES | C/C(=C\NCCCSCC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H31NS/c1-13(15(5,6)7)11-16-9-8-10-17-12-14(2,3)4/h11,16H,8-10,12H2,1-7H3/b13-11+ |
| InChIKey | ALJQHYDANJBKSR-ACCUITESSA-N |
| XLogP | 4.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|