About N'-pentan-3-yl-1H-1,2,4-triazole-5-sulfonohydrazide
N'-pentan-3-yl-1H-1,2,4-triazole-5-sulfonohydrazide (PubChem CID 138623144) has the molecular formula C7H15N5O2S
and a molecular weight of 233.30 g/mol. Its IUPAC name is N'-pentan-3-yl-1H-1,2,4-triazole-5-sulfonohydrazide.
Molecular Properties
| Compound Name | N'-pentan-3-yl-1H-1,2,4-triazole-5-sulfonohydrazide |
| PubChem CID | 138623144 |
| Molecular Formula | C7H15N5O2S |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | N'-pentan-3-yl-1H-1,2,4-triazole-5-sulfonohydrazide |
| SMILES | CCC(CC)NNS(=O)(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C7H15N5O2S/c1-3-6(4-2)10-12-15(13,14)7-8-5-9-11-7/h5-6,10,12H,3-4H2,1-2H3,(H,8,9,11) |
| InChIKey | VGJKDJIRJDCUBG-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-pentan-3-yl-1H-1,2,4-triazole-5-sulfonohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-pentan-3-yl-1H-1,2,4-triazole-5-sulfonohydrazide?
The IUPAC name of N'-pentan-3-yl-1H-1,2,4-triazole-5-sulfonohydrazide (CID 138623144) is N'-pentan-3-yl-1H-1,2,4-triazole-5-sulfonohydrazide.
What is the SMILES notation for N'-pentan-3-yl-1H-1,2,4-triazole-5-sulfonohydrazide?
The canonical SMILES for N'-pentan-3-yl-1H-1,2,4-triazole-5-sulfonohydrazide is CCC(CC)NNS(=O)(=O)c1ncn[nH]1.
What is the InChIKey of N'-pentan-3-yl-1H-1,2,4-triazole-5-sulfonohydrazide?
The InChIKey is VGJKDJIRJDCUBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N5O2S/c1-3-6(4-2)10-12-15(13,14)7-8-5-9-11-7/h5-6,10,12H,3-4H2,1-2H3,(H,8,9,11).
What are the key properties of N'-pentan-3-yl-1H-1,2,4-triazole-5-sulfonohydrazide?
N'-pentan-3-yl-1H-1,2,4-triazole-5-sulfonohydrazide has a molecular weight of 233.30 g/mol, XLogP of -0.22, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-pentan-3-yl-1H-1,2,4-triazole-5-sulfonohydrazide is sourced from PubChem (CID 138623144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).