C37H44FNO4 — CID 138623471
(2R,4aS,6aR,6aS,14aS,14bR)-8-(5-fluoro-1H-indol-3-yl)-10,11-dihydroxy-2,4a,6a,6a,9,14a-hexamethyl-3,4,5,6,8,13,14,14b-octahydro-1H-picene-2-carboxylic acid (PubChem CID 138623471) has the molecular formula C37H44FNO4 and a molecular weight of 585.76 g/mol. Its IUPAC name is (2R,4aS,6aR,6aS,14aS,14bR)-8-(5-fluoro-1H-indol-3-yl)-10,11-dihydroxy-2,4a,6a,6a,9,14a-hexamethyl-3,4,5,6,8,13,14,14b-octahydro-1H-picene-2-carboxylic acid.
| Compound Name | (2R,4aS,6aR,6aS,14aS,14bR)-8-(5-fluoro-1H-indol-3-yl)-10,11-dihydroxy-2,4a,6a,6a,9,14a-hexamethyl-3,4,5,6,8,13,14,14b-octahydro-1H-picene-2-carboxylic acid |
|---|---|
| PubChem CID | 138623471 |
| Molecular Formula | C37H44FNO4 |
| Molecular Weight | 585.76 g/mol |
| Exact Mass | 585.33 |
| IUPAC Name | (2R,4aS,6aR,6aS,14aS,14bR)-8-(5-fluoro-1H-indol-3-yl)-10,11-dihydroxy-2,4a,6a,6a,9,14a-hexamethyl-3,4,5,6,8,13,14,14b-octahydro-1H-picene-2-carboxylic acid |
| SMILES | Cc1c(O)c(O)cc2c1C(c1c[nH]c3ccc(F)cc13)C=C1[C@@]2(C)CC[C@@]2(C)[C@@H]3C[C@](C)(C(=O)O)CC[C@]3(C)CC[C@]12C |
| InChI | InChI=1S/C37H44FNO4/c1-20-30-23(24-19-39-26-8-7-21(38)15-22(24)26)16-28-35(4,25(30)17-27(40)31(20)41)12-14-37(6)29-18-34(3,32(42)43)10-9-33(29,2)11-13-36(28,37)5/h7-8,15-17,19,23,29,39-41H,9-14,18H2,1-6H3,(H,42,43)/t23?,29-,33-,34-,35+,36-,37+/m1/s1 |
| InChIKey | BOKDSCUBJABSLW-AYEYXTBHSA-N |
| XLogP | 8.85 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.76 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|