C24H22FNO2 — CID 138623779
3-[2-(4-fluorophenyl)ethyl]-3-hydroxy-1-[(2-methylphenyl)methyl]indol-2-one (PubChem CID 138623779) has the molecular formula C24H22FNO2 and a molecular weight of 375.44 g/mol. Its IUPAC name is 3-[2-(4-fluorophenyl)ethyl]-3-hydroxy-1-[(2-methylphenyl)methyl]indol-2-one.
| Compound Name | 3-[2-(4-fluorophenyl)ethyl]-3-hydroxy-1-[(2-methylphenyl)methyl]indol-2-one |
|---|---|
| PubChem CID | 138623779 |
| Molecular Formula | C24H22FNO2 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 3-[2-(4-fluorophenyl)ethyl]-3-hydroxy-1-[(2-methylphenyl)methyl]indol-2-one |
| SMILES | Cc1ccccc1CN1C(=O)C(O)(CCc2ccc(F)cc2)c2ccccc21 |
| InChI | InChI=1S/C24H22FNO2/c1-17-6-2-3-7-19(17)16-26-22-9-5-4-8-21(22)24(28,23(26)27)15-14-18-10-12-20(25)13-11-18/h2-13,28H,14-16H2,1H3 |
| InChIKey | DJJRYUQDHXJOFT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |