C14H22O — CID 138624051
(2S)-4-methyl-2-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]oxane (PubChem CID 138624051) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is (2S)-4-methyl-2-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]oxane.
| Compound Name | (2S)-4-methyl-2-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]oxane |
|---|---|
| PubChem CID | 138624051 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | (2S)-4-methyl-2-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]oxane |
| SMILES | C/C=C\C=C(/C=C\C)[C@@H]1CC(C)CCO1 |
| InChI | InChI=1S/C14H22O/c1-4-6-8-13(7-5-2)14-11-12(3)9-10-15-14/h4-8,12,14H,9-11H2,1-3H3/b6-4-,7-5-,13-8+/t12?,14-/m0/s1 |
| InChIKey | IAIVKCQHOUGSHG-XKEOXZRYSA-N |
| XLogP | 3.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|