About 7-tert-butyl-[1,3]thiazolo[5,4-c]pyridin-6-amine
7-tert-butyl-[1,3]thiazolo[5,4-c]pyridin-6-amine (PubChem CID 138624186) has the molecular formula C10H13N3S
and a molecular weight of 207.30 g/mol. Its IUPAC name is 7-tert-butyl-[1,3]thiazolo[5,4-c]pyridin-6-amine.
Molecular Properties
| Compound Name | 7-tert-butyl-[1,3]thiazolo[5,4-c]pyridin-6-amine |
| PubChem CID | 138624186 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 7-tert-butyl-[1,3]thiazolo[5,4-c]pyridin-6-amine |
| SMILES | CC(C)(C)c1c(N)ncc2scnc12 |
| InChI | InChI=1S/C10H13N3S/c1-10(2,3)7-8-6(14-5-13-8)4-12-9(7)11/h4-5H,1-3H3,(H2,11,12) |
| InChIKey | BKZKQZLAYGOENO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-tert-butyl-[1,3]thiazolo[5,4-c]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-tert-butyl-[1,3]thiazolo[5,4-c]pyridin-6-amine?
The IUPAC name of 7-tert-butyl-[1,3]thiazolo[5,4-c]pyridin-6-amine (CID 138624186) is 7-tert-butyl-[1,3]thiazolo[5,4-c]pyridin-6-amine.
What is the SMILES notation for 7-tert-butyl-[1,3]thiazolo[5,4-c]pyridin-6-amine?
The canonical SMILES for 7-tert-butyl-[1,3]thiazolo[5,4-c]pyridin-6-amine is CC(C)(C)c1c(N)ncc2scnc12.
What is the InChIKey of 7-tert-butyl-[1,3]thiazolo[5,4-c]pyridin-6-amine?
The InChIKey is BKZKQZLAYGOENO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3S/c1-10(2,3)7-8-6(14-5-13-8)4-12-9(7)11/h4-5H,1-3H3,(H2,11,12).
What are the key properties of 7-tert-butyl-[1,3]thiazolo[5,4-c]pyridin-6-amine?
7-tert-butyl-[1,3]thiazolo[5,4-c]pyridin-6-amine has a molecular weight of 207.30 g/mol, XLogP of 2.57, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-tert-butyl-[1,3]thiazolo[5,4-c]pyridin-6-amine is sourced from PubChem (CID 138624186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).