C8H15F2NO — CID 138624277
[(2S,3R)-5,5-difluoro-1,3-dimethylpiperidin-2-yl]methanol (PubChem CID 138624277) has the molecular formula C8H15F2NO and a molecular weight of 179.21 g/mol. Its IUPAC name is [(2S,3R)-5,5-difluoro-1,3-dimethylpiperidin-2-yl]methanol.
| Compound Name | [(2S,3R)-5,5-difluoro-1,3-dimethylpiperidin-2-yl]methanol |
|---|---|
| PubChem CID | 138624277 |
| Molecular Formula | C8H15F2NO |
| Molecular Weight | 179.21 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | [(2S,3R)-5,5-difluoro-1,3-dimethylpiperidin-2-yl]methanol |
| SMILES | C[C@@H]1CC(F)(F)CN(C)[C@@H]1CO |
| InChI | InChI=1S/C8H15F2NO/c1-6-3-8(9,10)5-11(2)7(6)4-12/h6-7,12H,3-5H2,1-2H3/t6-,7-/m1/s1 |
| InChIKey | QJMGQXJXCAHSKR-RNFRBKRXSA-N |
| XLogP | 0.95 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.21 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |