C30H23N3O6 — CID 138624342
1-[4-[3-(2,5-dioxopyrrol-1-yl)-4-[4-(2,5-dioxopyrrol-1-yl)phenyl]phenyl]cyclohexyl]pyrrole-2,5-dione (PubChem CID 138624342) has the molecular formula C30H23N3O6 and a molecular weight of 521.53 g/mol. Its IUPAC name is 1-[4-[3-(2,5-dioxopyrrol-1-yl)-4-[4-(2,5-dioxopyrrol-1-yl)phenyl]phenyl]cyclohexyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-[3-(2,5-dioxopyrrol-1-yl)-4-[4-(2,5-dioxopyrrol-1-yl)phenyl]phenyl]cyclohexyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 138624342 |
| Molecular Formula | C30H23N3O6 |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | 1-[4-[3-(2,5-dioxopyrrol-1-yl)-4-[4-(2,5-dioxopyrrol-1-yl)phenyl]phenyl]cyclohexyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1c1ccc(-c2ccc(C3CCC(N4C(=O)C=CC4=O)CC3)cc2N2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C30H23N3O6/c34-25-11-12-26(35)31(25)21-6-1-18(2-7-21)20-5-10-23(24(17-20)33-29(38)15-16-30(33)39)19-3-8-22(9-4-19)32-27(36)13-14-28(32)37/h3-5,8-18,21H,1-2,6-7H2 |
| InChIKey | YYOBGAYLKFOLOQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 112.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|