C22H36O4 — CID 138624549
[(1S,2R,3S,4S,6R,7R,8R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-hydroxyacetate (PubChem CID 138624549) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is [(1S,2R,3S,4S,6R,7R,8R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-hydroxyacetate.
| Compound Name | [(1S,2R,3S,4S,6R,7R,8R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-hydroxyacetate |
|---|---|
| PubChem CID | 138624549 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | [(1S,2R,3S,4S,6R,7R,8R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-hydroxyacetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CO)[C@]2(C)C(C)CC[C@]3(CCC[C@H]32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C22H36O4/c1-6-20(4)12-17(26-18(24)13-23)21(5)14(2)9-11-22(15(3)19(20)25)10-7-8-16(21)22/h6,14-17,19,23,25H,1,7-13H2,2-5H3/t14?,15-,16-,17+,19-,20+,21+,22+/m0/s1 |
| InChIKey | MUVWWMLPSGOINB-PAJWWSLOSA-N |
| XLogP | 3.71 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|