About 1,4-bis(trimethyl-λ4-sulfanyl)piperazine-2,5-dione
1,4-bis(trimethyl-λ4-sulfanyl)piperazine-2,5-dione (PubChem CID 138624741) has the molecular formula C10H22N2O2S2
and a molecular weight of 266.43 g/mol. Its IUPAC name is 1,4-bis(trimethyl-λ4-sulfanyl)piperazine-2,5-dione.
Molecular Properties
| Compound Name | 1,4-bis(trimethyl-λ4-sulfanyl)piperazine-2,5-dione |
| PubChem CID | 138624741 |
| Molecular Formula | C10H22N2O2S2 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 1,4-bis(trimethyl-λ4-sulfanyl)piperazine-2,5-dione |
| SMILES | CS(C)(C)N1CC(=O)N(S(C)(C)C)CC1=O |
| InChI | InChI=1S/C10H22N2O2S2/c1-15(2,3)11-7-10(14)12(8-9(11)13)16(4,5)6/h7-8H2,1-6H3 |
| InChIKey | YBICITKLCFFBQV-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-bis(trimethyl-λ4-sulfanyl)piperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis(trimethyl-λ4-sulfanyl)piperazine-2,5-dione?
The IUPAC name of 1,4-bis(trimethyl-λ4-sulfanyl)piperazine-2,5-dione (CID 138624741) is 1,4-bis(trimethyl-λ4-sulfanyl)piperazine-2,5-dione.
What is the SMILES notation for 1,4-bis(trimethyl-λ4-sulfanyl)piperazine-2,5-dione?
The canonical SMILES for 1,4-bis(trimethyl-λ4-sulfanyl)piperazine-2,5-dione is CS(C)(C)N1CC(=O)N(S(C)(C)C)CC1=O.
What is the InChIKey of 1,4-bis(trimethyl-λ4-sulfanyl)piperazine-2,5-dione?
The InChIKey is YBICITKLCFFBQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O2S2/c1-15(2,3)11-7-10(14)12(8-9(11)13)16(4,5)6/h7-8H2,1-6H3.
What are the key properties of 1,4-bis(trimethyl-λ4-sulfanyl)piperazine-2,5-dione?
1,4-bis(trimethyl-λ4-sulfanyl)piperazine-2,5-dione has a molecular weight of 266.43 g/mol, XLogP of 0.88, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis(trimethyl-λ4-sulfanyl)piperazine-2,5-dione is sourced from PubChem (CID 138624741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).