C17H17N3O3 — CID 138624840
(14S)-14-(aminomethyl)-3,6-dimethyl-16-oxa-3,13-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8,10-pentaene-4,12-dione (PubChem CID 138624840) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is (14S)-14-(aminomethyl)-3,6-dimethyl-16-oxa-3,13-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8,10-pentaene-4,12-dione.
| Compound Name | (14S)-14-(aminomethyl)-3,6-dimethyl-16-oxa-3,13-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8,10-pentaene-4,12-dione |
|---|---|
| PubChem CID | 138624840 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (14S)-14-(aminomethyl)-3,6-dimethyl-16-oxa-3,13-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8,10-pentaene-4,12-dione |
| SMILES | Cc1cc(=O)n(C)c2c3c4c(ccc(=O)n4[C@@H](CN)CO3)cc12 |
| InChI | InChI=1S/C17H17N3O3/c1-9-5-14(22)19(2)16-12(9)6-10-3-4-13(21)20-11(7-18)8-23-17(16)15(10)20/h3-6,11H,7-8,18H2,1-2H3/t11-/m0/s1 |
| InChIKey | MGURXQCAQSGAJH-NSHDSACASA-N |
| XLogP | 1.05 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|