C31H30N2O12 — CID 138625056
[5-[[3,5-bis[(3,5-dihydroxyphenyl)methoxy]phenyl]methoxy]-2-nitrooxyphenyl]methyl N-ethylcarbamate (PubChem CID 138625056) has the molecular formula C31H30N2O12 and a molecular weight of 622.58 g/mol. Its IUPAC name is [5-[[3,5-bis[(3,5-dihydroxyphenyl)methoxy]phenyl]methoxy]-2-nitrooxyphenyl]methyl N-ethylcarbamate.
| Compound Name | [5-[[3,5-bis[(3,5-dihydroxyphenyl)methoxy]phenyl]methoxy]-2-nitrooxyphenyl]methyl N-ethylcarbamate |
|---|---|
| PubChem CID | 138625056 |
| Molecular Formula | C31H30N2O12 |
| Molecular Weight | 622.58 g/mol |
| Exact Mass | 622.18 |
| IUPAC Name | [5-[[3,5-bis[(3,5-dihydroxyphenyl)methoxy]phenyl]methoxy]-2-nitrooxyphenyl]methyl N-ethylcarbamate |
| SMILES | CCNC(=O)OCc1cc(OCc2cc(OCc3cc(O)cc(O)c3)cc(OCc3cc(O)cc(O)c3)c2)ccc1O[N+](=O)[O-] |
| InChI | InChI=1S/C31H30N2O12/c1-2-32-31(38)44-18-22-11-27(3-4-30(22)45-33(39)40)41-17-21-9-28(42-15-19-5-23(34)12-24(35)6-19)14-29(10-21)43-16-20-7-25(36)13-26(37)8-20/h3-14,34-37H,2,15-18H2,1H3,(H,32,38) |
| InChIKey | VDQOBVNNQXMALT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 199.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.58 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|