C26H38F2N4O14P2 — CID 138625069
2-[2-[2-[[4-(fluoroamino)-2-(hydroxymethyl)pentoxy]-hydroxyphosphoryl]oxyethyl]-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl]ethyl [4-(fluoroamino)-2-(hydroxymethyl)pentyl] hydrogen phosphate (PubChem CID 138625069) has the molecular formula C26H38F2N4O14P2 and a molecular weight of 730.55 g/mol. Its IUPAC name is 2-[2-[2-[[4-(fluoroamino)-2-(hydroxymethyl)pentoxy]-hydroxyphosphoryl]oxyethyl]-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl]ethyl [4-(fluoroamino)-2-(hydroxymethyl)pentyl] hydrogen phosphate.
| Compound Name | 2-[2-[2-[[4-(fluoroamino)-2-(hydroxymethyl)pentoxy]-hydroxyphosphoryl]oxyethyl]-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl]ethyl [4-(fluoroamino)-2-(hydroxymethyl)pentyl] hydrogen phosphate |
|---|---|
| PubChem CID | 138625069 |
| Molecular Formula | C26H38F2N4O14P2 |
| Molecular Weight | 730.55 g/mol |
| Exact Mass | 730.18 |
| IUPAC Name | 2-[2-[2-[[4-(fluoroamino)-2-(hydroxymethyl)pentoxy]-hydroxyphosphoryl]oxyethyl]-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl]ethyl [4-(fluoroamino)-2-(hydroxymethyl)pentyl] hydrogen phosphate |
| SMILES | CC(CC(CO)COP(=O)(O)OCCn1c(=O)c2cc3c(=O)n(CCOP(=O)(O)OCC(CO)CC(C)NF)c(=O)c3cc2c1=O)NF |
| InChI | InChI=1S/C26H38F2N4O14P2/c1-15(29-27)7-17(11-33)13-45-47(39,40)43-5-3-31-23(35)19-9-21-22(10-20(19)24(31)36)26(38)32(25(21)37)4-6-44-48(41,42)46-14-18(12-34)8-16(2)30-28/h9-10,15-18,29-30,33-34H,3-8,11-14H2,1-2H3,(H,39,40)(H,41,42) |
| InChIKey | CDSWPHMQTMUTCM-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 254.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.55 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|