C19H32N2 — CID 138625092
3-[(4E,6E)-2-aminoocta-4,6-dien-2-yl]-4-ethenyl-N,4-dimethylcyclohept-2-en-1-amine (PubChem CID 138625092) has the molecular formula C19H32N2 and a molecular weight of 288.48 g/mol. Its IUPAC name is 3-[(4E,6E)-2-aminoocta-4,6-dien-2-yl]-4-ethenyl-N,4-dimethylcyclohept-2-en-1-amine.
| Compound Name | 3-[(4E,6E)-2-aminoocta-4,6-dien-2-yl]-4-ethenyl-N,4-dimethylcyclohept-2-en-1-amine |
|---|---|
| PubChem CID | 138625092 |
| Molecular Formula | C19H32N2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.26 |
| IUPAC Name | 3-[(4E,6E)-2-aminoocta-4,6-dien-2-yl]-4-ethenyl-N,4-dimethylcyclohept-2-en-1-amine |
| SMILES | C=CC1(C)CCCC(NC)C=C1C(C)(N)C/C=C/C=C/C |
| InChI | InChI=1S/C19H32N2/c1-6-8-9-10-14-19(4,20)17-15-16(21-5)12-11-13-18(17,3)7-2/h6-10,15-16,21H,2,11-14,20H2,1,3-5H3/b8-6+,10-9+ |
| InChIKey | BGOWPTFGBQFTQX-QGHYKFKQSA-N |
| XLogP | 4.12 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|