C20H22N2O4 — CID 138625096
ethyl (1S,5S)-4-(5-acetyloxy-1,1-dicyanopent-3-ynyl)-5-ethenylcyclohex-3-ene-1-carboxylate (PubChem CID 138625096) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is ethyl (1S,5S)-4-(5-acetyloxy-1,1-dicyanopent-3-ynyl)-5-ethenylcyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1S,5S)-4-(5-acetyloxy-1,1-dicyanopent-3-ynyl)-5-ethenylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 138625096 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | ethyl (1S,5S)-4-(5-acetyloxy-1,1-dicyanopent-3-ynyl)-5-ethenylcyclohex-3-ene-1-carboxylate |
| SMILES | C=C[C@@H]1C[C@@H](C(=O)OCC)CC=C1C(C#N)(C#N)CC#CCOC(C)=O |
| InChI | InChI=1S/C20H22N2O4/c1-4-16-12-17(19(24)25-5-2)8-9-18(16)20(13-21,14-22)10-6-7-11-26-15(3)23/h4,9,16-17H,1,5,8,10-12H2,2-3H3/t16-,17+/m1/s1 |
| InChIKey | LBGAEQZGDDYFLN-SJORKVTESA-N |
| XLogP | 2.68 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|