C21H22N2O4 — CID 138625119
ethyl (1S,5S)-4-(5-acetyloxy-1,1-dicyanopent-3-ynyl)-5-propa-1,2-dienylcyclohex-3-ene-1-carboxylate (PubChem CID 138625119) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is ethyl (1S,5S)-4-(5-acetyloxy-1,1-dicyanopent-3-ynyl)-5-propa-1,2-dienylcyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1S,5S)-4-(5-acetyloxy-1,1-dicyanopent-3-ynyl)-5-propa-1,2-dienylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 138625119 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | ethyl (1S,5S)-4-(5-acetyloxy-1,1-dicyanopent-3-ynyl)-5-propa-1,2-dienylcyclohex-3-ene-1-carboxylate |
| SMILES | C=C=C[C@@H]1C[C@@H](C(=O)OCC)CC=C1C(C#N)(C#N)CC#CCOC(C)=O |
| InChI | InChI=1S/C21H22N2O4/c1-4-8-17-13-18(20(25)26-5-2)9-10-19(17)21(14-22,15-23)11-6-7-12-27-16(3)24/h8,10,17-18H,1,5,9,11-13H2,2-3H3/t17-,18+/m1/s1 |
| InChIKey | HVFBFZZJWAKBCK-MSOLQXFVSA-N |
| XLogP | 2.83 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|